C16H32NO5S+ — CID 91595397
diethyl-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]-(3-methylsulfonylpropyl)azanium (PubChem CID 91595397) has the molecular formula C16H32NO5S+ and a molecular weight of 350.50 g/mol. Its IUPAC name is diethyl-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]-(3-methylsulfonylpropyl)azanium.
| Compound Name | diethyl-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]-(3-methylsulfonylpropyl)azanium |
|---|---|
| PubChem CID | 91595397 |
| Molecular Formula | C16H32NO5S+ |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | diethyl-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]-(3-methylsulfonylpropyl)azanium |
| SMILES | C=C(C)C(=O)OCCOCC[N+](CC)(CC)CCCS(C)(=O)=O |
| InChI | InChI=1S/C16H32NO5S/c1-6-17(7-2,9-8-14-23(5,19)20)10-11-21-12-13-22-16(18)15(3)4/h3,6-14H2,1-2,4-5H3/q+1 |
| InChIKey | XKOCICDFRUICEC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|