C13H26NO6S+ — CID 22013342
dimethyl-[1-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]-(3-sulfopropyl)azanium (PubChem CID 22013342) has the molecular formula C13H26NO6S+ and a molecular weight of 324.42 g/mol. Its IUPAC name is dimethyl-[1-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]-(3-sulfopropyl)azanium.
| Compound Name | dimethyl-[1-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 22013342 |
| Molecular Formula | C13H26NO6S+ |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | dimethyl-[1-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]-(3-sulfopropyl)azanium |
| SMILES | C=C(C)C(=O)OCCOC(C)[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C13H25NO6S/c1-11(2)13(15)20-9-8-19-12(3)14(4,5)7-6-10-21(16,17)18/h12H,1,6-10H2,2-5H3/p+1 |
| InChIKey | ASLSQCRIVXEHCC-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|