C15H31N2O5S+ — CID 174486124
2-(dimethylamino)propanoic acid;methyl-bis(prop-2-enyl)-(3-sulfopropyl)azanium (PubChem CID 174486124) has the molecular formula C15H31N2O5S+ and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;methyl-bis(prop-2-enyl)-(3-sulfopropyl)azanium.
| Compound Name | 2-(dimethylamino)propanoic acid;methyl-bis(prop-2-enyl)-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 174486124 |
| Molecular Formula | C15H31N2O5S+ |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;methyl-bis(prop-2-enyl)-(3-sulfopropyl)azanium |
| SMILES | C=CC[N+](C)(CC=C)CCCS(=O)(=O)O.CC(C(=O)O)N(C)C |
| InChI | InChI=1S/C10H19NO3S.C5H11NO2/c1-4-7-11(3,8-5-2)9-6-10-15(12,13)14;1-4(5(7)8)6(2)3/h4-5H,1-2,6-10H2,3H3;4H,1-3H3,(H,7,8)/p+1 |
| InChIKey | ONHYAZVJOAIWBR-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|