C10H24N2O5S — CID 174659054
2-(dimethylamino)propanoic acid;3-(ethylamino)propane-1-sulfonic acid (PubChem CID 174659054) has the molecular formula C10H24N2O5S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;3-(ethylamino)propane-1-sulfonic acid.
| Compound Name | 2-(dimethylamino)propanoic acid;3-(ethylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174659054 |
| Molecular Formula | C10H24N2O5S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;3-(ethylamino)propane-1-sulfonic acid |
| SMILES | CC(C(=O)O)N(C)C.CCNCCCS(=O)(=O)O |
| InChI | InChI=1S/C5H13NO3S.C5H11NO2/c1-2-6-4-3-5-10(7,8)9;1-4(5(7)8)6(2)3/h6H,2-5H2,1H3,(H,7,8,9);4H,1-3H3,(H,7,8) |
| InChIKey | NEORLCJEFUFABG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|