C12H24N2O4 — CID 174301541
2-(dimethylamino)propanoic acid;prop-2-enyl 2-amino-2-methylpropanoate (PubChem CID 174301541) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;prop-2-enyl 2-amino-2-methylpropanoate.
| Compound Name | 2-(dimethylamino)propanoic acid;prop-2-enyl 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 174301541 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;prop-2-enyl 2-amino-2-methylpropanoate |
| SMILES | C=CCOC(=O)C(C)(C)N.CC(C(=O)O)N(C)C |
| InChI | InChI=1S/C7H13NO2.C5H11NO2/c1-4-5-10-6(9)7(2,3)8;1-4(5(7)8)6(2)3/h4H,1,5,8H2,2-3H3;4H,1-3H3,(H,7,8) |
| InChIKey | WNCOLGPQXGUJDQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|