C11H21N3O2 — CID 174370876
2-(dimethylamino)propanoic acid;1-prop-2-enyl-4,5-dihydroimidazole (PubChem CID 174370876) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;1-prop-2-enyl-4,5-dihydroimidazole.
| Compound Name | 2-(dimethylamino)propanoic acid;1-prop-2-enyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 174370876 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;1-prop-2-enyl-4,5-dihydroimidazole |
| SMILES | C=CCN1C=NCC1.CC(C(=O)O)N(C)C |
| InChI | InChI=1S/C6H10N2.C5H11NO2/c1-2-4-8-5-3-7-6-8;1-4(5(7)8)6(2)3/h2,6H,1,3-5H2;4H,1-3H3,(H,7,8) |
| InChIKey | JOLJTDSTKDJCSI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|