About 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid
2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid (PubChem CID 174675191) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid.
Molecular Properties
| Compound Name | 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid |
| PubChem CID | 174675191 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid |
| SMILES | C=CCc1nccn1CC=CC(=O)O.CC(C(=O)O)N(C)C |
| InChI | InChI=1S/C10H12N2O2.C5H11NO2/c1-2-4-9-11-6-8-12(9)7-3-5-10(13)14;1-4(5(7)8)6(2)3/h2-3,5-6,8H,1,4,7H2,(H,13,14);4H,1-3H3,(H,7,8) |
| InChIKey | DTBZEMAPMYWKKL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid?
The IUPAC name of 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid (CID 174675191) is 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid.
What is the SMILES notation for 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid?
The canonical SMILES for 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid is C=CCc1nccn1CC=CC(=O)O.CC(C(=O)O)N(C)C.
What is the InChIKey of 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid?
The InChIKey is DTBZEMAPMYWKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2.C5H11NO2/c1-2-4-9-11-6-8-12(9)7-3-5-10(13)14;1-4(5(7)8)6(2)3/h2-3,5-6,8H,1,4,7H2,(H,13,14);4H,1-3H3,(H,7,8).
What are the key properties of 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid?
2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid has a molecular weight of 309.37 g/mol, XLogP of 1.27, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid is sourced from PubChem (CID 174675191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).