C15H23N3O4 — CID 174675191
2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid (PubChem CID 174675191) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid.
| Compound Name | 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 174675191 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;4-(2-prop-2-enylimidazol-1-yl)but-2-enoic acid |
| SMILES | C=CCc1nccn1CC=CC(=O)O.CC(C(=O)O)N(C)C |
| InChI | InChI=1S/C10H12N2O2.C5H11NO2/c1-2-4-9-11-6-8-12(9)7-3-5-10(13)14;1-4(5(7)8)6(2)3/h2-3,5-6,8H,1,4,7H2,(H,13,14);4H,1-3H3,(H,7,8) |
| InChIKey | DTBZEMAPMYWKKL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|