C11H19N3O3 — CID 131905578
(2S)-2-[[1-(2-methoxyethyl)imidazol-2-yl]methyl-methylamino]propanoic acid (PubChem CID 131905578) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2S)-2-[[1-(2-methoxyethyl)imidazol-2-yl]methyl-methylamino]propanoic acid.
| Compound Name | (2S)-2-[[1-(2-methoxyethyl)imidazol-2-yl]methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 131905578 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | (2S)-2-[[1-(2-methoxyethyl)imidazol-2-yl]methyl-methylamino]propanoic acid |
| SMILES | COCCn1ccnc1CN(C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C11H19N3O3/c1-9(11(15)16)13(2)8-10-12-4-5-14(10)6-7-17-3/h4-5,9H,6-8H2,1-3H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | XQQVNXANDGJGHW-VIFPVBQESA-N |
| XLogP | 0.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |