C17H26N4O — CID 94600630
(2R)-N-[[1-(2-methoxyethyl)imidazol-2-yl]methyl]-N-(pyridin-3-ylmethyl)butan-2-amine (PubChem CID 94600630) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is (2R)-N-[[1-(2-methoxyethyl)imidazol-2-yl]methyl]-N-(pyridin-3-ylmethyl)butan-2-amine.
| Compound Name | (2R)-N-[[1-(2-methoxyethyl)imidazol-2-yl]methyl]-N-(pyridin-3-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 94600630 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (2R)-N-[[1-(2-methoxyethyl)imidazol-2-yl]methyl]-N-(pyridin-3-ylmethyl)butan-2-amine |
| SMILES | CC[C@@H](C)N(Cc1cccnc1)Cc1nccn1CCOC |
| InChI | InChI=1S/C17H26N4O/c1-4-15(2)21(13-16-6-5-7-18-12-16)14-17-19-8-9-20(17)10-11-22-3/h5-9,12,15H,4,10-11,13-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | ALMCBJJHSHFIIF-OAHLLOKOSA-N |
| XLogP | 2.73 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |