About 2-(dimethylamino)propanoic acid;4-ethenylpyridine
2-(dimethylamino)propanoic acid;4-ethenylpyridine (PubChem CID 174623561) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;4-ethenylpyridine.
Molecular Properties
| Compound Name | 2-(dimethylamino)propanoic acid;4-ethenylpyridine |
| PubChem CID | 174623561 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;4-ethenylpyridine |
| SMILES | C=Cc1ccncc1.CC(C(=O)O)N(C)C |
| InChI | InChI=1S/C7H7N.C5H11NO2/c1-2-7-3-5-8-6-4-7;1-4(5(7)8)6(2)3/h2-6H,1H2;4H,1-3H3,(H,7,8) |
| InChIKey | ZMVXNQIVLZKJGU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylamino)propanoic acid;4-ethenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)propanoic acid;4-ethenylpyridine?
The IUPAC name of 2-(dimethylamino)propanoic acid;4-ethenylpyridine (CID 174623561) is 2-(dimethylamino)propanoic acid;4-ethenylpyridine.
What is the SMILES notation for 2-(dimethylamino)propanoic acid;4-ethenylpyridine?
The canonical SMILES for 2-(dimethylamino)propanoic acid;4-ethenylpyridine is C=Cc1ccncc1.CC(C(=O)O)N(C)C.
What is the InChIKey of 2-(dimethylamino)propanoic acid;4-ethenylpyridine?
The InChIKey is ZMVXNQIVLZKJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N.C5H11NO2/c1-2-7-3-5-8-6-4-7;1-4(5(7)8)6(2)3/h2-6H,1H2;4H,1-3H3,(H,7,8).
What are the key properties of 2-(dimethylamino)propanoic acid;4-ethenylpyridine?
2-(dimethylamino)propanoic acid;4-ethenylpyridine has a molecular weight of 222.29 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propanoic acid;4-ethenylpyridine is sourced from PubChem (CID 174623561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).