C14H27N3O3 — CID 70498652
3-(4,5-dihydroimidazol-1-yl)prop-1-en-1-ol;2-[methyl(pentyl)amino]acetic acid (PubChem CID 70498652) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(4,5-dihydroimidazol-1-yl)prop-1-en-1-ol;2-[methyl(pentyl)amino]acetic acid.
| Compound Name | 3-(4,5-dihydroimidazol-1-yl)prop-1-en-1-ol;2-[methyl(pentyl)amino]acetic acid |
|---|---|
| PubChem CID | 70498652 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 3-(4,5-dihydroimidazol-1-yl)prop-1-en-1-ol;2-[methyl(pentyl)amino]acetic acid |
| SMILES | CCCCCN(C)CC(=O)O.OC=CCN1C=NCC1 |
| InChI | InChI=1S/C8H17NO2.C6H10N2O/c1-3-4-5-6-9(2)7-8(10)11;9-5-1-3-8-4-2-7-6-8/h3-7H2,1-2H3,(H,10,11);1,5-6,9H,2-4H2 |
| InChIKey | MJEVWIYEFWEYNG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|