About sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid
sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid (PubChem CID 173150786) has the molecular formula C21H42NNaO2
and a molecular weight of 363.56 g/mol. Its IUPAC name is sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid.
Molecular Properties
| Compound Name | sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid |
| PubChem CID | 173150786 |
| Molecular Formula | C21H42NNaO2 |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(C)CC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C21H41NO2.Na.H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(2)20-21(23)24;;/h10-11H,3-9,12-20H2,1-2H3,(H,23,24);;/q;+1;-1/b11-10-;; |
| InChIKey | AZMOYMBSIBUFHA-PQBRBDCOSA-N |
| XLogP | 3.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid?
The IUPAC name of sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid (CID 173150786) is sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid.
What is the SMILES notation for sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid?
The canonical SMILES for sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid is CCCCCCCC/C=C\CCCCCCCCN(C)CC(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid?
The InChIKey is AZMOYMBSIBUFHA-PQBRBDCOSA-N. The full InChI is InChI=1S/C21H41NO2.Na.H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(2)20-21(23)24;;/h10-11H,3-9,12-20H2,1-2H3,(H,23,24);;/q;+1;-1/b11-10-;;.
What are the key properties of sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid?
sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid has a molecular weight of 363.56 g/mol, XLogP of 3.16, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]acetic acid is sourced from PubChem (CID 173150786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).