C22H40N2O9S — CID 160767943
3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate;3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propanoate (PubChem CID 160767943) has the molecular formula C22H40N2O9S and a molecular weight of 508.63 g/mol. Its IUPAC name is 3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate;3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propanoate.
| Compound Name | 3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate;3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propanoate |
|---|---|
| PubChem CID | 160767943 |
| Molecular Formula | C22H40N2O9S |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate;3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propanoate |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CCC(=O)[O-].C=C(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H21NO5S.C11H19NO4/c1-10(2)11(13)17-8-7-12(3,4)6-5-9-18(14,15)16;1-9(2)11(15)16-8-7-12(3,4)6-5-10(13)14/h1,5-9H2,2-4H3;1,5-8H2,2-4H3 |
| InChIKey | RYXVDCRBDOEKIQ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 149.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|