C15H31NO5S — CID 20759324
3-[dimethyl-[2-(2,2,3,3-tetramethylbutanoyloxy)ethyl]azaniumyl]propane-1-sulfonate (PubChem CID 20759324) has the molecular formula C15H31NO5S and a molecular weight of 337.48 g/mol. Its IUPAC name is 3-[dimethyl-[2-(2,2,3,3-tetramethylbutanoyloxy)ethyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 3-[dimethyl-[2-(2,2,3,3-tetramethylbutanoyloxy)ethyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20759324 |
| Molecular Formula | C15H31NO5S |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 3-[dimethyl-[2-(2,2,3,3-tetramethylbutanoyloxy)ethyl]azaniumyl]propane-1-sulfonate |
| SMILES | CC(C)(C)C(C)(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H31NO5S/c1-14(2,3)15(4,5)13(17)21-11-10-16(6,7)9-8-12-22(18,19)20/h8-12H2,1-7H3 |
| InChIKey | RTTMFHZZEMOGJL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|