C18H35NO7S — CID 123695106
3-[dimethyl-[2-(2,2,4-trimethyl-5-oxo-5-propoxypentanoyl)oxyethyl]azaniumyl]propane-1-sulfonate (PubChem CID 123695106) has the molecular formula C18H35NO7S and a molecular weight of 409.55 g/mol. Its IUPAC name is 3-[dimethyl-[2-(2,2,4-trimethyl-5-oxo-5-propoxypentanoyl)oxyethyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 3-[dimethyl-[2-(2,2,4-trimethyl-5-oxo-5-propoxypentanoyl)oxyethyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 123695106 |
| Molecular Formula | C18H35NO7S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 3-[dimethyl-[2-(2,2,4-trimethyl-5-oxo-5-propoxypentanoyl)oxyethyl]azaniumyl]propane-1-sulfonate |
| SMILES | CCCOC(=O)C(C)CC(C)(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H35NO7S/c1-7-11-25-16(20)15(2)14-18(3,4)17(21)26-12-10-19(5,6)9-8-13-27(22,23)24/h15H,7-14H2,1-6H3 |
| InChIKey | LOPWTXLHPCLSMF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|