C20H39NO7S — CID 123819619
3-[dimethyl-[2-[2,2,4,4-tetramethyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]oxyethyl]azaniumyl]propane-1-sulfonate (PubChem CID 123819619) has the molecular formula C20H39NO7S and a molecular weight of 437.60 g/mol. Its IUPAC name is 3-[dimethyl-[2-[2,2,4,4-tetramethyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]oxyethyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 3-[dimethyl-[2-[2,2,4,4-tetramethyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]oxyethyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 123819619 |
| Molecular Formula | C20H39NO7S |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 3-[dimethyl-[2-[2,2,4,4-tetramethyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]oxyethyl]azaniumyl]propane-1-sulfonate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)CC(C)(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C20H39NO7S/c1-18(2,3)28-17(23)20(6,7)15-19(4,5)16(22)27-13-12-21(8,9)11-10-14-29(24,25)26/h10-15H2,1-9H3 |
| InChIKey | HMUXEAADJSSSED-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|