C19H38NO7S+ — CID 90180350
dimethyl-(3-sulfopropyl)-[2-(2,2,4,4-tetramethyl-5-oxo-5-propoxypentanoyl)oxyethyl]azanium (PubChem CID 90180350) has the molecular formula C19H38NO7S+ and a molecular weight of 424.58 g/mol. Its IUPAC name is dimethyl-(3-sulfopropyl)-[2-(2,2,4,4-tetramethyl-5-oxo-5-propoxypentanoyl)oxyethyl]azanium.
| Compound Name | dimethyl-(3-sulfopropyl)-[2-(2,2,4,4-tetramethyl-5-oxo-5-propoxypentanoyl)oxyethyl]azanium |
|---|---|
| PubChem CID | 90180350 |
| Molecular Formula | C19H38NO7S+ |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | dimethyl-(3-sulfopropyl)-[2-(2,2,4,4-tetramethyl-5-oxo-5-propoxypentanoyl)oxyethyl]azanium |
| SMILES | CCCOC(=O)C(C)(C)CC(C)(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C19H37NO7S/c1-8-12-26-16(21)18(2,3)15-19(4,5)17(22)27-13-11-20(6,7)10-9-14-28(23,24)25/h8-15H2,1-7H3/p+1 |
| InChIKey | DCISWMVQWCJCTB-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|