C19H37NO7S — CID 123355432
3-[2-(5-butoxy-2,2,4-trimethyl-5-oxopentanoyl)oxyethyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 123355432) has the molecular formula C19H37NO7S and a molecular weight of 423.57 g/mol. Its IUPAC name is 3-[2-(5-butoxy-2,2,4-trimethyl-5-oxopentanoyl)oxyethyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[2-(5-butoxy-2,2,4-trimethyl-5-oxopentanoyl)oxyethyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 123355432 |
| Molecular Formula | C19H37NO7S |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 3-[2-(5-butoxy-2,2,4-trimethyl-5-oxopentanoyl)oxyethyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | CCCCOC(=O)C(C)CC(C)(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H37NO7S/c1-7-8-12-26-17(21)16(2)15-19(3,4)18(22)27-13-11-20(5,6)10-9-14-28(23,24)25/h16H,7-15H2,1-6H3 |
| InChIKey | PRKUTTSDXIICCO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|