C20H35N2O2+ — CID 90180331
butyl-[2-(2,2-dimethyl-4-pyridin-2-ylpentanoyl)oxyethyl]-dimethylazanium (PubChem CID 90180331) has the molecular formula C20H35N2O2+ and a molecular weight of 335.51 g/mol. Its IUPAC name is butyl-[2-(2,2-dimethyl-4-pyridin-2-ylpentanoyl)oxyethyl]-dimethylazanium.
| Compound Name | butyl-[2-(2,2-dimethyl-4-pyridin-2-ylpentanoyl)oxyethyl]-dimethylazanium |
|---|---|
| PubChem CID | 90180331 |
| Molecular Formula | C20H35N2O2+ |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | butyl-[2-(2,2-dimethyl-4-pyridin-2-ylpentanoyl)oxyethyl]-dimethylazanium |
| SMILES | CCCC[N+](C)(C)CCOC(=O)C(C)(C)CC(C)c1ccccn1 |
| InChI | InChI=1S/C20H35N2O2/c1-7-8-13-22(5,6)14-15-24-19(23)20(3,4)16-17(2)18-11-9-10-12-21-18/h9-12,17H,7-8,13-16H2,1-6H3/q+1 |
| InChIKey | MQYDCYIPKVWTEW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|