About (3S)-3-pyridin-2-ylbutanoic acid;sulfane
(3S)-3-pyridin-2-ylbutanoic acid;sulfane (PubChem CID 167654157) has the molecular formula C9H13NO2S
and a molecular weight of 199.28 g/mol. Its IUPAC name is (3S)-3-pyridin-2-ylbutanoic acid;sulfane.
Molecular Properties
| Compound Name | (3S)-3-pyridin-2-ylbutanoic acid;sulfane |
| PubChem CID | 167654157 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | (3S)-3-pyridin-2-ylbutanoic acid;sulfane |
| SMILES | C[C@@H](CC(=O)O)c1ccccn1.S |
| InChI | InChI=1S/C9H11NO2.H2S/c1-7(6-9(11)12)8-4-2-3-5-10-8;/h2-5,7H,6H2,1H3,(H,11,12);1H2/t7-;/m0./s1 |
| InChIKey | QZVYSSQVXAVFBY-FJXQXJEOSA-N |
| XLogP | 1.77 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-pyridin-2-ylbutanoic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-pyridin-2-ylbutanoic acid;sulfane?
The IUPAC name of (3S)-3-pyridin-2-ylbutanoic acid;sulfane (CID 167654157) is (3S)-3-pyridin-2-ylbutanoic acid;sulfane.
What is the SMILES notation for (3S)-3-pyridin-2-ylbutanoic acid;sulfane?
The canonical SMILES for (3S)-3-pyridin-2-ylbutanoic acid;sulfane is C[C@@H](CC(=O)O)c1ccccn1.S.
What is the InChIKey of (3S)-3-pyridin-2-ylbutanoic acid;sulfane?
The InChIKey is QZVYSSQVXAVFBY-FJXQXJEOSA-N. The full InChI is InChI=1S/C9H11NO2.H2S/c1-7(6-9(11)12)8-4-2-3-5-10-8;/h2-5,7H,6H2,1H3,(H,11,12);1H2/t7-;/m0./s1.
What are the key properties of (3S)-3-pyridin-2-ylbutanoic acid;sulfane?
(3S)-3-pyridin-2-ylbutanoic acid;sulfane has a molecular weight of 199.28 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-pyridin-2-ylbutanoic acid;sulfane is sourced from PubChem (CID 167654157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).