C19H32NO2+ — CID 23545031
benzyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-diethylazanium (PubChem CID 23545031) has the molecular formula C19H32NO2+ and a molecular weight of 306.47 g/mol. Its IUPAC name is benzyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-diethylazanium.
| Compound Name | benzyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-diethylazanium |
|---|---|
| PubChem CID | 23545031 |
| Molecular Formula | C19H32NO2+ |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | benzyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-diethylazanium |
| SMILES | CCC(C)(C)C(=O)OCC[N+](CC)(CC)Cc1ccccc1 |
| InChI | InChI=1S/C19H32NO2/c1-6-19(4,5)18(21)22-15-14-20(7-2,8-3)16-17-12-10-9-11-13-17/h9-13H,6-8,14-16H2,1-5H3/q+1 |
| InChIKey | FHUOJNYHCIDMPR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|