C18H30NO2+ — CID 59513253
2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(2-phenylethyl)azanium (PubChem CID 59513253) has the molecular formula C18H30NO2+ and a molecular weight of 292.44 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(2-phenylethyl)azanium.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 59513253 |
| Molecular Formula | C18H30NO2+ |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(2-phenylethyl)azanium |
| SMILES | CCC(C)(C)C(=O)OCC[N+](C)(C)CCc1ccccc1 |
| InChI | InChI=1S/C18H30NO2/c1-6-18(2,3)17(20)21-15-14-19(4,5)13-12-16-10-8-7-9-11-16/h7-11H,6,12-15H2,1-5H3/q+1 |
| InChIKey | IOSFOPNWKLMILS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|