C17H22O4 — CID 74046505
2-(3-phenylprop-2-enoyloxy)ethyl 2,2-dimethylbutanoate (PubChem CID 74046505) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(3-phenylprop-2-enoyloxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(3-phenylprop-2-enoyloxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 74046505 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(3-phenylprop-2-enoyloxy)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H22O4/c1-4-17(2,3)16(19)21-13-12-20-15(18)11-10-14-8-6-5-7-9-14/h5-11H,4,12-13H2,1-3H3 |
| InChIKey | MQPYYVUFVBJZKE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|