C24H36O4 — CID 155639547
2-[(E)-3-(4-heptylphenyl)prop-2-enoyl]oxyethyl 2,2-dimethylbutanoate (PubChem CID 155639547) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-[(E)-3-(4-heptylphenyl)prop-2-enoyl]oxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[(E)-3-(4-heptylphenyl)prop-2-enoyl]oxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 155639547 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[(E)-3-(4-heptylphenyl)prop-2-enoyl]oxyethyl 2,2-dimethylbutanoate |
| SMILES | CCCCCCCc1ccc(/C=C/C(=O)OCCOC(=O)C(C)(C)CC)cc1 |
| InChI | InChI=1S/C24H36O4/c1-5-7-8-9-10-11-20-12-14-21(15-13-20)16-17-22(25)27-18-19-28-23(26)24(3,4)6-2/h12-17H,5-11,18-19H2,1-4H3/b17-16+ |
| InChIKey | WNMHELJOVABIHN-WUKNDPDISA-N |
| XLogP | 5.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|