C37H44O8 — CID 121473977
[4-[(E)-3-oxo-3-pentoxyprop-1-enyl]phenyl] 4-[4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]phenyl]benzoate (PubChem CID 121473977) has the molecular formula C37H44O8 and a molecular weight of 616.75 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-pentoxyprop-1-enyl]phenyl] 4-[4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]phenyl]benzoate.
| Compound Name | [4-[(E)-3-oxo-3-pentoxyprop-1-enyl]phenyl] 4-[4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 121473977 |
| Molecular Formula | C37H44O8 |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | [4-[(E)-3-oxo-3-pentoxyprop-1-enyl]phenyl] 4-[4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]phenyl]benzoate |
| SMILES | CCCCCOC(=O)/C=C/c1ccc(OC(=O)c2ccc(-c3ccc(OCCOCCOC(=O)C(C)(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H44O8/c1-5-7-8-23-43-34(38)22-11-28-9-18-33(19-10-28)45-35(39)31-14-12-29(13-15-31)30-16-20-32(21-17-30)42-26-24-41-25-27-44-36(40)37(3,4)6-2/h9-22H,5-8,23-27H2,1-4H3/b22-11+ |
| InChIKey | MCQLMUZRDHVIJN-SSDVNMTOSA-N |
| XLogP | 7.69 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|