C33H48O8 — CID 91069379
butyl 4-[4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]phenyl]benzoate;2,2-dimethylbutanoic acid (PubChem CID 91069379) has the molecular formula C33H48O8 and a molecular weight of 572.74 g/mol. Its IUPAC name is butyl 4-[4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]phenyl]benzoate;2,2-dimethylbutanoic acid.
| Compound Name | butyl 4-[4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]phenyl]benzoate;2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 91069379 |
| Molecular Formula | C33H48O8 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | butyl 4-[4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]phenyl]benzoate;2,2-dimethylbutanoic acid |
| SMILES | CCC(C)(C)C(=O)O.CCCCOC(=O)c1ccc(-c2ccc(OCCOCCOC(=O)C(C)(C)CC)cc2)cc1 |
| InChI | InChI=1S/C27H36O6.C6H12O2/c1-5-7-16-32-25(28)23-10-8-21(9-11-23)22-12-14-24(15-13-22)31-19-17-30-18-20-33-26(29)27(3,4)6-2;1-4-6(2,3)5(7)8/h8-15H,5-7,16-20H2,1-4H3;4H2,1-3H3,(H,7,8) |
| InChIKey | RINYNTHFCWQIOR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|