C33H34O3 — CID 156654615
2-(4-tritylphenoxy)ethyl 2,2-dimethylbutanoate (PubChem CID 156654615) has the molecular formula C33H34O3 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-(4-tritylphenoxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(4-tritylphenoxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 156654615 |
| Molecular Formula | C33H34O3 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 2-(4-tritylphenoxy)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOc1ccc(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H34O3/c1-4-32(2,3)31(34)36-25-24-35-30-22-20-29(21-23-30)33(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-23H,4,24-25H2,1-3H3 |
| InChIKey | DEZCYCOLRREOBW-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|