C21H22O4S — CID 118603261
2-(9-oxothioxanthen-2-yl)oxyethyl 2,2-dimethylbutanoate (PubChem CID 118603261) has the molecular formula C21H22O4S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-(9-oxothioxanthen-2-yl)oxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(9-oxothioxanthen-2-yl)oxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118603261 |
| Molecular Formula | C21H22O4S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-(9-oxothioxanthen-2-yl)oxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C21H22O4S/c1-4-21(2,3)20(23)25-12-11-24-14-9-10-18-16(13-14)19(22)15-7-5-6-8-17(15)26-18/h5-10,13H,4,11-12H2,1-3H3 |
| InChIKey | AXXDXBHOFKUKTK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|