C34H26O8S2 — CID 148664093
2-[3-oxo-4-(9-oxothioxanthen-2-yl)oxybutan-2-yl]oxyethyl 2-(9-oxothioxanthen-2-yl)oxyacetate (PubChem CID 148664093) has the molecular formula C34H26O8S2 and a molecular weight of 626.71 g/mol. Its IUPAC name is 2-[3-oxo-4-(9-oxothioxanthen-2-yl)oxybutan-2-yl]oxyethyl 2-(9-oxothioxanthen-2-yl)oxyacetate.
| Compound Name | 2-[3-oxo-4-(9-oxothioxanthen-2-yl)oxybutan-2-yl]oxyethyl 2-(9-oxothioxanthen-2-yl)oxyacetate |
|---|---|
| PubChem CID | 148664093 |
| Molecular Formula | C34H26O8S2 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.11 |
| IUPAC Name | 2-[3-oxo-4-(9-oxothioxanthen-2-yl)oxybutan-2-yl]oxyethyl 2-(9-oxothioxanthen-2-yl)oxyacetate |
| SMILES | CC(OCCOC(=O)COc1ccc2sc3ccccc3c(=O)c2c1)C(=O)COc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C34H26O8S2/c1-20(27(35)18-41-21-10-12-30-25(16-21)33(37)23-6-2-4-8-28(23)43-30)39-14-15-40-32(36)19-42-22-11-13-31-26(17-22)34(38)24-7-3-5-9-29(24)44-31/h2-13,16-17,20H,14-15,18-19H2,1H3 |
| InChIKey | NOJOIMRXWLGJHY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|