C19H18O4S — CID 143687369
2-(3-methoxy-3-methyl-2-oxobutoxy)thioxanthen-9-one (PubChem CID 143687369) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(3-methoxy-3-methyl-2-oxobutoxy)thioxanthen-9-one.
| Compound Name | 2-(3-methoxy-3-methyl-2-oxobutoxy)thioxanthen-9-one |
|---|---|
| PubChem CID | 143687369 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-(3-methoxy-3-methyl-2-oxobutoxy)thioxanthen-9-one |
| SMILES | COC(C)(C)C(=O)COc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C19H18O4S/c1-19(2,22-3)17(20)11-23-12-8-9-16-14(10-12)18(21)13-6-4-5-7-15(13)24-16/h4-10H,11H2,1-3H3 |
| InChIKey | BCDZZBLIIAHCMZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|