About (9-oxothioxanthen-2-yl) 2-bromoacetate
(9-oxothioxanthen-2-yl) 2-bromoacetate (PubChem CID 118069117) has the molecular formula C15H9BrO3S
and a molecular weight of 349.21 g/mol. Its IUPAC name is (9-oxothioxanthen-2-yl) 2-bromoacetate.
Molecular Properties
| Compound Name | (9-oxothioxanthen-2-yl) 2-bromoacetate |
| PubChem CID | 118069117 |
| Molecular Formula | C15H9BrO3S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | (9-oxothioxanthen-2-yl) 2-bromoacetate |
| SMILES | O=C(CBr)Oc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C15H9BrO3S/c16-8-14(17)19-9-5-6-13-11(7-9)15(18)10-3-1-2-4-12(10)20-13/h1-7H,8H2 |
| InChIKey | GAWGXNRYJNZSGC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (9-oxothioxanthen-2-yl) 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-oxothioxanthen-2-yl) 2-bromoacetate?
The IUPAC name of (9-oxothioxanthen-2-yl) 2-bromoacetate (CID 118069117) is (9-oxothioxanthen-2-yl) 2-bromoacetate.
What is the SMILES notation for (9-oxothioxanthen-2-yl) 2-bromoacetate?
The canonical SMILES for (9-oxothioxanthen-2-yl) 2-bromoacetate is O=C(CBr)Oc1ccc2sc3ccccc3c(=O)c2c1.
What is the InChIKey of (9-oxothioxanthen-2-yl) 2-bromoacetate?
The InChIKey is GAWGXNRYJNZSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrO3S/c16-8-14(17)19-9-5-6-13-11(7-9)15(18)10-3-1-2-4-12(10)20-13/h1-7H,8H2.
What are the key properties of (9-oxothioxanthen-2-yl) 2-bromoacetate?
(9-oxothioxanthen-2-yl) 2-bromoacetate has a molecular weight of 349.21 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-oxothioxanthen-2-yl) 2-bromoacetate is sourced from PubChem (CID 118069117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).