C19H19NO5S — CID 58434152
N,N-bis(2-hydroxyethyl)-2-(9-oxothioxanthen-2-yl)oxyacetamide (PubChem CID 58434152) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-(9-oxothioxanthen-2-yl)oxyacetamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-(9-oxothioxanthen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 58434152 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-(9-oxothioxanthen-2-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2sc3ccccc3c(=O)c2c1)N(CCO)CCO |
| InChI | InChI=1S/C19H19NO5S/c21-9-7-20(8-10-22)18(23)12-25-13-5-6-17-15(11-13)19(24)14-3-1-2-4-16(14)26-17/h1-6,11,21-22H,7-10,12H2 |
| InChIKey | LNHYGSFZOGQLNI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|