C22H24N2O6S — CID 177068580
N-(2-hydroxyethyl)-2-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethoxy]-N-methyl-9-oxothioxanthene-3-carboxamide (PubChem CID 177068580) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethoxy]-N-methyl-9-oxothioxanthene-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-2-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethoxy]-N-methyl-9-oxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 177068580 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethoxy]-N-methyl-9-oxothioxanthene-3-carboxamide |
| SMILES | CN(CCO)C(=O)COc1cc2c(=O)c3ccccc3sc2cc1C(=O)N(C)CCO |
| InChI | InChI=1S/C22H24N2O6S/c1-23(7-9-25)20(27)13-30-17-11-16-19(12-15(17)22(29)24(2)8-10-26)31-18-6-4-3-5-14(18)21(16)28/h3-6,11-12,25-26H,7-10,13H2,1-2H3 |
| InChIKey | BELHDMBLVURGPA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|