C28H35NO6S — CID 144801614
6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate (PubChem CID 144801614) has the molecular formula C28H35NO6S and a molecular weight of 513.66 g/mol. Its IUPAC name is 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate.
| Compound Name | 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate |
|---|---|
| PubChem CID | 144801614 |
| Molecular Formula | C28H35NO6S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate |
| SMILES | CCCCN(CCC(=O)OCCCCCCO)C(=O)COc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C28H35NO6S/c1-2-3-15-29(16-14-27(32)34-18-9-5-4-8-17-30)26(31)20-35-21-12-13-25-23(19-21)28(33)22-10-6-7-11-24(22)36-25/h6-7,10-13,19,30H,2-5,8-9,14-18,20H2,1H3 |
| InChIKey | HCCJUVWYHKXKPU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|