About 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate
6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate (PubChem CID 144801614) has the molecular formula C28H35NO6S
and a molecular weight of 513.66 g/mol. Its IUPAC name is 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate |
| PubChem CID | 144801614 |
| Molecular Formula | C28H35NO6S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate |
| SMILES | CCCCN(CCC(=O)OCCCCCCO)C(=O)COc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C28H35NO6S/c1-2-3-15-29(16-14-27(32)34-18-9-5-4-8-17-30)26(31)20-35-21-12-13-25-23(19-21)28(33)22-10-6-7-11-24(22)36-25/h6-7,10-13,19,30H,2-5,8-9,14-18,20H2,1H3 |
| InChIKey | HCCJUVWYHKXKPU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate?
The IUPAC name of 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate (CID 144801614) is 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate.
What is the SMILES notation for 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate?
The canonical SMILES for 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate is CCCCN(CCC(=O)OCCCCCCO)C(=O)COc1ccc2sc3ccccc3c(=O)c2c1.
What is the InChIKey of 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate?
The InChIKey is HCCJUVWYHKXKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H35NO6S/c1-2-3-15-29(16-14-27(32)34-18-9-5-4-8-17-30)26(31)20-35-21-12-13-25-23(19-21)28(33)22-10-6-7-11-24(22)36-25/h6-7,10-13,19,30H,2-5,8-9,14-18,20H2,1H3.
What are the key properties of 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate?
6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate has a molecular weight of 513.66 g/mol, XLogP of 4.91, 15 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl 3-[butyl-[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]propanoate is sourced from PubChem (CID 144801614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).