C16H14O3S — CID 143903572
2-(3-hydroxypropoxy)thioxanthen-9-one (PubChem CID 143903572) has the molecular formula C16H14O3S and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-(3-hydroxypropoxy)thioxanthen-9-one.
| Compound Name | 2-(3-hydroxypropoxy)thioxanthen-9-one |
|---|---|
| PubChem CID | 143903572 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-(3-hydroxypropoxy)thioxanthen-9-one |
| SMILES | O=c1c2ccccc2sc2ccc(OCCCO)cc12 |
| InChI | InChI=1S/C16H14O3S/c17-8-3-9-19-11-6-7-15-13(10-11)16(18)12-4-1-2-5-14(12)20-15/h1-2,4-7,10,17H,3,8-9H2 |
| InChIKey | ILYYZQCXFFMKJY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|