C21H23NO6S — CID 123638637
2-[bis(2-hydroxyethyl)amino]ethyl 2-(9-oxothioxanthen-2-yl)oxyacetate (PubChem CID 123638637) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethyl 2-(9-oxothioxanthen-2-yl)oxyacetate.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethyl 2-(9-oxothioxanthen-2-yl)oxyacetate |
|---|---|
| PubChem CID | 123638637 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethyl 2-(9-oxothioxanthen-2-yl)oxyacetate |
| SMILES | O=C(COc1ccc2sc3ccccc3c(=O)c2c1)OCCN(CCO)CCO |
| InChI | InChI=1S/C21H23NO6S/c23-10-7-22(8-11-24)9-12-27-20(25)14-28-15-5-6-19-17(13-15)21(26)16-3-1-2-4-18(16)29-19/h1-6,13,23-24H,7-12,14H2 |
| InChIKey | AVNDTBOTQDEZOL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|