C16H12O4S — CID 67352192
3-(9-oxothioxanthen-2-yl)oxypropanoic acid (PubChem CID 67352192) has the molecular formula C16H12O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-(9-oxothioxanthen-2-yl)oxypropanoic acid.
| Compound Name | 3-(9-oxothioxanthen-2-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 67352192 |
| Molecular Formula | C16H12O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-(9-oxothioxanthen-2-yl)oxypropanoic acid |
| SMILES | O=C(O)CCOc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C16H12O4S/c17-15(18)7-8-20-10-5-6-14-12(9-10)16(19)11-3-1-2-4-13(11)21-14/h1-6,9H,7-8H2,(H,17,18) |
| InChIKey | OPQCCJXTUFVZBR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|