C42H46N4O8S2 — CID 126487155
N-[2-[methyl-[2-[2-[2-[methyl-[2-[[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]ethyl]amino]ethoxy]ethoxy]ethyl]amino]ethyl]-2-(9-oxothioxanthen-2-yl)oxyacetamide (PubChem CID 126487155) has the molecular formula C42H46N4O8S2 and a molecular weight of 798.98 g/mol. Its IUPAC name is N-[2-[methyl-[2-[2-[2-[methyl-[2-[[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]ethyl]amino]ethoxy]ethoxy]ethyl]amino]ethyl]-2-(9-oxothioxanthen-2-yl)oxyacetamide.
| Compound Name | N-[2-[methyl-[2-[2-[2-[methyl-[2-[[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]ethyl]amino]ethoxy]ethoxy]ethyl]amino]ethyl]-2-(9-oxothioxanthen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 126487155 |
| Molecular Formula | C42H46N4O8S2 |
| Molecular Weight | 798.98 g/mol |
| Exact Mass | 798.28 |
| IUPAC Name | N-[2-[methyl-[2-[2-[2-[methyl-[2-[[2-(9-oxothioxanthen-2-yl)oxyacetyl]amino]ethyl]amino]ethoxy]ethoxy]ethyl]amino]ethyl]-2-(9-oxothioxanthen-2-yl)oxyacetamide |
| SMILES | CN(CCNC(=O)COc1ccc2sc3ccccc3c(=O)c2c1)CCOCCOCCN(C)CCNC(=O)COc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C42H46N4O8S2/c1-45(17-15-43-39(47)27-53-29-11-13-37-33(25-29)41(49)31-7-3-5-9-35(31)55-37)19-21-51-23-24-52-22-20-46(2)18-16-44-40(48)28-54-30-12-14-38-34(26-30)42(50)32-8-4-6-10-36(32)56-38/h3-14,25-26H,15-24,27-28H2,1-2H3,(H,43,47)(H,44,48) |
| InChIKey | IJHNINHGVIRUJU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.98 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|