C32H23O8S2+ — CID 171830964
methyl 2-[7-[2-(2-methoxy-2-oxoethoxy)-9-oxothioxanthen-10-ium-10-yl]-9-oxothioxanthen-2-yl]oxyacetate (PubChem CID 171830964) has the molecular formula C32H23O8S2+ and a molecular weight of 599.66 g/mol. Its IUPAC name is methyl 2-[7-[2-(2-methoxy-2-oxoethoxy)-9-oxothioxanthen-10-ium-10-yl]-9-oxothioxanthen-2-yl]oxyacetate.
| Compound Name | methyl 2-[7-[2-(2-methoxy-2-oxoethoxy)-9-oxothioxanthen-10-ium-10-yl]-9-oxothioxanthen-2-yl]oxyacetate |
|---|---|
| PubChem CID | 171830964 |
| Molecular Formula | C32H23O8S2+ |
| Molecular Weight | 599.66 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | methyl 2-[7-[2-(2-methoxy-2-oxoethoxy)-9-oxothioxanthen-10-ium-10-yl]-9-oxothioxanthen-2-yl]oxyacetate |
| SMILES | COC(=O)COc1ccc2sc3ccc(-[s+]4c5ccccc5c(=O)c5cc(OCC(=O)OC)ccc54)cc3c(=O)c2c1 |
| InChI | InChI=1S/C32H23O8S2/c1-37-29(33)16-39-18-7-10-25-22(13-18)32(36)23-15-20(9-11-26(23)41-25)42-27-6-4-3-5-21(27)31(35)24-14-19(8-12-28(24)42)40-17-30(34)38-2/h3-15H,16-17H2,1-2H3/q+1 |
| InChIKey | PJQSQQYQFGXGJR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|