C11H12Cl3NO3 — CID 60652730
N-(2-hydroxyethyl)-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 60652730) has the molecular formula C11H12Cl3NO3 and a molecular weight of 312.58 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2-hydroxyethyl)-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 60652730 |
| Molecular Formula | C11H12Cl3NO3 |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | N-(2-hydroxyethyl)-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CN(CCO)C(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3NO3/c1-15(2-3-16)11(17)6-18-10-5-8(13)7(12)4-9(10)14/h4-5,16H,2-3,6H2,1H3 |
| InChIKey | LKHZEJIKLOAFFD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|