C16H14Cl6O4 — CID 87745106
2-(2,4,5-trichlorophenoxy)ethanol (PubChem CID 87745106) has the molecular formula C16H14Cl6O4 and a molecular weight of 483.00 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenoxy)ethanol.
| Compound Name | 2-(2,4,5-trichlorophenoxy)ethanol |
|---|---|
| PubChem CID | 87745106 |
| Molecular Formula | C16H14Cl6O4 |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 479.90 |
| IUPAC Name | 2-(2,4,5-trichlorophenoxy)ethanol |
| SMILES | OCCOc1cc(Cl)c(Cl)cc1Cl.OCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/2C8H7Cl3O2/c2*9-5-3-7(11)8(4-6(5)10)13-2-1-12/h2*3-4,12H,1-2H2 |
| InChIKey | IBSIAYNIWCSCSP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|