C10H9Cl3O2 — CID 155213152
4-(2,4,5-trichlorophenoxy)butanal (PubChem CID 155213152) has the molecular formula C10H9Cl3O2 and a molecular weight of 267.54 g/mol. Its IUPAC name is 4-(2,4,5-trichlorophenoxy)butanal.
| Compound Name | 4-(2,4,5-trichlorophenoxy)butanal |
|---|---|
| PubChem CID | 155213152 |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | 4-(2,4,5-trichlorophenoxy)butanal |
| SMILES | O=CCCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl3O2/c11-7-5-9(13)10(6-8(7)12)15-4-2-1-3-14/h3,5-6H,1-2,4H2 |
| InChIKey | MQHOFWGMOKDDOJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|