C12H14Cl4O2 — CID 54022479
1,4-dichloro-2,5-bis(3-chloropropoxy)benzene (PubChem CID 54022479) has the molecular formula C12H14Cl4O2 and a molecular weight of 332.05 g/mol. Its IUPAC name is 1,4-dichloro-2,5-bis(3-chloropropoxy)benzene.
| Compound Name | 1,4-dichloro-2,5-bis(3-chloropropoxy)benzene |
|---|---|
| PubChem CID | 54022479 |
| Molecular Formula | C12H14Cl4O2 |
| Molecular Weight | 332.05 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 1,4-dichloro-2,5-bis(3-chloropropoxy)benzene |
| SMILES | ClCCCOc1cc(Cl)c(OCCCCl)cc1Cl |
| InChI | InChI=1S/C12H14Cl4O2/c13-3-1-5-17-11-7-10(16)12(8-9(11)15)18-6-2-4-14/h7-8H,1-6H2 |
| InChIKey | KZWYOULWADTEMK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.05 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|