C9H8BrCl3O — CID 148761209
5-bromo-1,3-dichloro-2-(3-chloropropoxy)benzene (PubChem CID 148761209) has the molecular formula C9H8BrCl3O and a molecular weight of 318.43 g/mol. Its IUPAC name is 5-bromo-1,3-dichloro-2-(3-chloropropoxy)benzene.
| Compound Name | 5-bromo-1,3-dichloro-2-(3-chloropropoxy)benzene |
|---|---|
| PubChem CID | 148761209 |
| Molecular Formula | C9H8BrCl3O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 315.88 |
| IUPAC Name | 5-bromo-1,3-dichloro-2-(3-chloropropoxy)benzene |
| SMILES | ClCCCOc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C9H8BrCl3O/c10-6-4-7(12)9(8(13)5-6)14-3-1-2-11/h4-5H,1-3H2 |
| InChIKey | OGPDOBWESONBRR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|