5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride

C9H8BrCl2FO3S — CID 81106546

IUPAC5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Br)cc(Cl)c1OCCCF
InChIInChI=1S/C9H8BrCl2FO3S/c10-6-4-7(11)9(16-3-1-2-13)8(5-6)17(12,14)15/h4-5H,1-3H2
InChIKeyDLKRGDYYKOSMQE-UHFFFAOYSA-N
MW366.04 g/mol
LogP3.77
Rot. Bonds5

About 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride

5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride (PubChem CID 81106546) has the molecular formula C9H8BrCl2FO3S and a molecular weight of 366.04 g/mol. Its IUPAC name is 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride.

Molecular Properties

Compound Name5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride
PubChem CID81106546
Molecular FormulaC9H8BrCl2FO3S
Molecular Weight366.04 g/mol
Exact Mass363.87
IUPAC Name5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Br)cc(Cl)c1OCCCF
InChIInChI=1S/C9H8BrCl2FO3S/c10-6-4-7(11)9(16-3-1-2-13)8(5-6)17(12,14)15/h4-5H,1-3H2
InChIKeyDLKRGDYYKOSMQE-UHFFFAOYSA-N
XLogP3.77
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.04
LogP ≤ 53.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride?
The IUPAC name of 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride (CID 81106546) is 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride.
What is the SMILES notation for 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride?
The canonical SMILES for 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride is O=S(=O)(Cl)c1cc(Br)cc(Cl)c1OCCCF.
What is the InChIKey of 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride?
The InChIKey is DLKRGDYYKOSMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrCl2FO3S/c10-6-4-7(11)9(16-3-1-2-13)8(5-6)17(12,14)15/h4-5H,1-3H2.
What are the key properties of 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride?
5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride has a molecular weight of 366.04 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-chloro-2-(3-fluoropropoxy)benzenesulfonyl chloride is sourced from PubChem (CID 81106546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).