5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride

C15H22BrClO3S — CID 63495664

IUPAC5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride
SMILESCCCCCCCCOc1c(C)cc(Br)cc1S(=O)(=O)Cl
InChIInChI=1S/C15H22BrClO3S/c1-3-4-5-6-7-8-9-20-15-12(2)10-13(16)11-14(15)21(17,18)19/h10-11H,3-9H2,1-2H3
InChIKeyOTWCMJBTBHCCKW-UHFFFAOYSA-N
MW397.76 g/mol
LogP5.42
Rot. Bonds9

About 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride

5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride (PubChem CID 63495664) has the molecular formula C15H22BrClO3S and a molecular weight of 397.76 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride.

Molecular Properties

Compound Name5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride
PubChem CID63495664
Molecular FormulaC15H22BrClO3S
Molecular Weight397.76 g/mol
Exact Mass396.02
IUPAC Name5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride
SMILESCCCCCCCCOc1c(C)cc(Br)cc1S(=O)(=O)Cl
InChIInChI=1S/C15H22BrClO3S/c1-3-4-5-6-7-8-9-20-15-12(2)10-13(16)11-14(15)21(17,18)19/h10-11H,3-9H2,1-2H3
InChIKeyOTWCMJBTBHCCKW-UHFFFAOYSA-N
XLogP5.42
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500397.76
LogP ≤ 55.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride?
The IUPAC name of 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride (CID 63495664) is 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride.
What is the SMILES notation for 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride?
The canonical SMILES for 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride is CCCCCCCCOc1c(C)cc(Br)cc1S(=O)(=O)Cl.
What is the InChIKey of 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride?
The InChIKey is OTWCMJBTBHCCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrClO3S/c1-3-4-5-6-7-8-9-20-15-12(2)10-13(16)11-14(15)21(17,18)19/h10-11H,3-9H2,1-2H3.
What are the key properties of 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride?
5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride has a molecular weight of 397.76 g/mol, XLogP of 5.42, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-methyl-2-octoxybenzenesulfonyl chloride is sourced from PubChem (CID 63495664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).