C20H24Br2O2 — CID 58759064
5-bromo-2-[4-(4-bromo-2,6-dimethylphenoxy)butoxy]-1,3-dimethylbenzene (PubChem CID 58759064) has the molecular formula C20H24Br2O2 and a molecular weight of 456.22 g/mol. Its IUPAC name is 5-bromo-2-[4-(4-bromo-2,6-dimethylphenoxy)butoxy]-1,3-dimethylbenzene.
| Compound Name | 5-bromo-2-[4-(4-bromo-2,6-dimethylphenoxy)butoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 58759064 |
| Molecular Formula | C20H24Br2O2 |
| Molecular Weight | 456.22 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 5-bromo-2-[4-(4-bromo-2,6-dimethylphenoxy)butoxy]-1,3-dimethylbenzene |
| SMILES | Cc1cc(Br)cc(C)c1OCCCCOc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C20H24Br2O2/c1-13-9-17(21)10-14(2)19(13)23-7-5-6-8-24-20-15(3)11-18(22)12-16(20)4/h9-12H,5-8H2,1-4H3 |
| InChIKey | ATOMSZUVFFFOMN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.22 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|