C11H15BrO2 — CID 67625955
5-bromo-2-(ethoxymethoxy)-1,3-dimethylbenzene (PubChem CID 67625955) has the molecular formula C11H15BrO2 and a molecular weight of 259.14 g/mol. Its IUPAC name is 5-bromo-2-(ethoxymethoxy)-1,3-dimethylbenzene.
| Compound Name | 5-bromo-2-(ethoxymethoxy)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 67625955 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 5-bromo-2-(ethoxymethoxy)-1,3-dimethylbenzene |
| SMILES | CCOCOc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C11H15BrO2/c1-4-13-7-14-11-8(2)5-10(12)6-9(11)3/h5-6H,4,7H2,1-3H3 |
| InChIKey | PHEIFKGUJIKKTC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|