C13H21BrNO+ — CID 2182043
3-(4-bromo-2,6-dimethylphenoxy)propyl-dimethylazanium (PubChem CID 2182043) has the molecular formula C13H21BrNO+ and a molecular weight of 287.22 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenoxy)propyl-dimethylazanium.
| Compound Name | 3-(4-bromo-2,6-dimethylphenoxy)propyl-dimethylazanium |
|---|---|
| PubChem CID | 2182043 |
| Molecular Formula | C13H21BrNO+ |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenoxy)propyl-dimethylazanium |
| SMILES | Cc1cc(Br)cc(C)c1OCCC[NH+](C)C |
| InChI | InChI=1S/C13H20BrNO/c1-10-8-12(14)9-11(2)13(10)16-7-5-6-15(3)4/h8-9H,5-7H2,1-4H3/p+1 |
| InChIKey | VJJKBFGQOCVTRA-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|