C12H18BrNO — CID 27047233
3-(4-bromo-2,6-dimethylphenoxy)-N-methylpropan-1-amine (PubChem CID 27047233) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenoxy)-N-methylpropan-1-amine.
| Compound Name | 3-(4-bromo-2,6-dimethylphenoxy)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 27047233 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenoxy)-N-methylpropan-1-amine |
| SMILES | CNCCCOc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C12H18BrNO/c1-9-7-11(13)8-10(2)12(9)15-6-4-5-14-3/h7-8,14H,4-6H2,1-3H3 |
| InChIKey | IOPXJCHUVJINMI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|